C14H21O4P — CID 139018639
5-(2-diethoxyphosphorylethyl)-2,3-dihydro-1-benzofuran (PubChem CID 139018639) has the molecular formula C14H21O4P and a molecular weight of 284.29 g/mol. Its IUPAC name is 5-(2-diethoxyphosphorylethyl)-2,3-dihydro-1-benzofuran.
| Compound Name | 5-(2-diethoxyphosphorylethyl)-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 139018639 |
| Molecular Formula | C14H21O4P |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 5-(2-diethoxyphosphorylethyl)-2,3-dihydro-1-benzofuran |
| SMILES | CCOP(=O)(CCc1ccc2c(c1)CCO2)OCC |
| InChI | InChI=1S/C14H21O4P/c1-3-17-19(15,18-4-2)10-8-12-5-6-14-13(11-12)7-9-16-14/h5-6,11H,3-4,7-10H2,1-2H3 |
| InChIKey | BYYCVIKANWFFTB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|