C12H23N3O3 — CID 81203509
[2-(hydroxymethyl)-5-methylmorpholin-4-yl]-(5-methylpiperazin-2-yl)methanone (PubChem CID 81203509) has the molecular formula C12H23N3O3 and a molecular weight of 257.33 g/mol. Its IUPAC name is [2-(hydroxymethyl)-5-methylmorpholin-4-yl]-(5-methylpiperazin-2-yl)methanone.
| Compound Name | [2-(hydroxymethyl)-5-methylmorpholin-4-yl]-(5-methylpiperazin-2-yl)methanone |
|---|---|
| PubChem CID | 81203509 |
| Molecular Formula | C12H23N3O3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | [2-(hydroxymethyl)-5-methylmorpholin-4-yl]-(5-methylpiperazin-2-yl)methanone |
| SMILES | CC1CNC(C(=O)N2CC(CO)OCC2C)CN1 |
| InChI | InChI=1S/C12H23N3O3/c1-8-3-14-11(4-13-8)12(17)15-5-10(6-16)18-7-9(15)2/h8-11,13-14,16H,3-7H2,1-2H3 |
| InChIKey | WSIUEQJEWONFKQ-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |