C8H8BrF2NOS — CID 81207080
4-bromo-2-(2,2-difluoroethylsulfinyl)aniline (PubChem CID 81207080) has the molecular formula C8H8BrF2NOS and a molecular weight of 284.12 g/mol. Its IUPAC name is 4-bromo-2-(2,2-difluoroethylsulfinyl)aniline.
| Compound Name | 4-bromo-2-(2,2-difluoroethylsulfinyl)aniline |
|---|---|
| PubChem CID | 81207080 |
| Molecular Formula | C8H8BrF2NOS |
| Molecular Weight | 284.12 g/mol |
| Exact Mass | 282.95 |
| IUPAC Name | 4-bromo-2-(2,2-difluoroethylsulfinyl)aniline |
| SMILES | Nc1ccc(Br)cc1S(=O)CC(F)F |
| InChI | InChI=1S/C8H8BrF2NOS/c9-5-1-2-6(12)7(3-5)14(13)4-8(10)11/h1-3,8H,4,12H2 |
| InChIKey | KTNLMLPBWZHXIK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.12 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|