C16H24N2O — CID 81215510
5-ethyl-2-methyl-4-(1,2,3,4-tetrahydroquinolin-6-yl)morpholine (PubChem CID 81215510) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 5-ethyl-2-methyl-4-(1,2,3,4-tetrahydroquinolin-6-yl)morpholine.
| Compound Name | 5-ethyl-2-methyl-4-(1,2,3,4-tetrahydroquinolin-6-yl)morpholine |
|---|---|
| PubChem CID | 81215510 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 5-ethyl-2-methyl-4-(1,2,3,4-tetrahydroquinolin-6-yl)morpholine |
| SMILES | CCC1COC(C)CN1c1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C16H24N2O/c1-3-14-11-19-12(2)10-18(14)15-6-7-16-13(9-15)5-4-8-17-16/h6-7,9,12,14,17H,3-5,8,10-11H2,1-2H3 |
| InChIKey | ONGYSKIADBEDCQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |