C13H12F3N3O — CID 81257990
N-benzyl-N-(2,2,2-trifluoroethyl)imidazole-1-carboxamide (PubChem CID 81257990) has the molecular formula C13H12F3N3O and a molecular weight of 283.25 g/mol. Its IUPAC name is N-benzyl-N-(2,2,2-trifluoroethyl)imidazole-1-carboxamide.
| Compound Name | N-benzyl-N-(2,2,2-trifluoroethyl)imidazole-1-carboxamide |
|---|---|
| PubChem CID | 81257990 |
| Molecular Formula | C13H12F3N3O |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | N-benzyl-N-(2,2,2-trifluoroethyl)imidazole-1-carboxamide |
| SMILES | O=C(N(Cc1ccccc1)CC(F)(F)F)n1ccnc1 |
| InChI | InChI=1S/C13H12F3N3O/c14-13(15,16)9-19(8-11-4-2-1-3-5-11)12(20)18-7-6-17-10-18/h1-7,10H,8-9H2 |
| InChIKey | TYZCTQWFHOAYNH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |