C14H17F2NO3S — CID 81264869
4-(2-bicyclo[2.2.1]heptanylmethoxy)-3,5-difluorobenzenesulfonamide (PubChem CID 81264869) has the molecular formula C14H17F2NO3S and a molecular weight of 317.36 g/mol. Its IUPAC name is 4-(2-bicyclo[2.2.1]heptanylmethoxy)-3,5-difluorobenzenesulfonamide.
| Compound Name | 4-(2-bicyclo[2.2.1]heptanylmethoxy)-3,5-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 81264869 |
| Molecular Formula | C14H17F2NO3S |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 4-(2-bicyclo[2.2.1]heptanylmethoxy)-3,5-difluorobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(F)c(OCC2CC3CCC2C3)c(F)c1 |
| InChI | InChI=1S/C14H17F2NO3S/c15-12-5-11(21(17,18)19)6-13(16)14(12)20-7-10-4-8-1-2-9(10)3-8/h5-6,8-10H,1-4,7H2,(H2,17,18,19) |
| InChIKey | TYJSHSSXQREERY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |