C9H11FN2O4 — CID 81297634
ethyl 2-fluoro-2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetate (PubChem CID 81297634) has the molecular formula C9H11FN2O4 and a molecular weight of 230.19 g/mol. Its IUPAC name is ethyl 2-fluoro-2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetate.
| Compound Name | ethyl 2-fluoro-2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetate |
|---|---|
| PubChem CID | 81297634 |
| Molecular Formula | C9H11FN2O4 |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | ethyl 2-fluoro-2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetate |
| SMILES | CCOC(=O)C(F)n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H11FN2O4/c1-3-16-8(14)6(10)12-4-5(2)7(13)11-9(12)15/h4,6H,3H2,1-2H3,(H,11,13,15) |
| InChIKey | OXBOBGONZNYKID-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |