C13H17Br2NO4S — CID 81319438
2-[butan-2-yl-(2,5-dibromo-4-methylphenyl)sulfonylamino]acetic acid (PubChem CID 81319438) has the molecular formula C13H17Br2NO4S and a molecular weight of 443.16 g/mol. Its IUPAC name is 2-[butan-2-yl-(2,5-dibromo-4-methylphenyl)sulfonylamino]acetic acid.
| Compound Name | 2-[butan-2-yl-(2,5-dibromo-4-methylphenyl)sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 81319438 |
| Molecular Formula | C13H17Br2NO4S |
| Molecular Weight | 443.16 g/mol |
| Exact Mass | 440.92 |
| IUPAC Name | 2-[butan-2-yl-(2,5-dibromo-4-methylphenyl)sulfonylamino]acetic acid |
| SMILES | CCC(C)N(CC(=O)O)S(=O)(=O)c1cc(Br)c(C)cc1Br |
| InChI | InChI=1S/C13H17Br2NO4S/c1-4-9(3)16(7-13(17)18)21(19,20)12-6-10(14)8(2)5-11(12)15/h5-6,9H,4,7H2,1-3H3,(H,17,18) |
| InChIKey | CNAMYPQABMYZRR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.16 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |