C10H18N2OS — CID 81334842
3-(1-ethoxypropan-2-yl)-4-ethyl-1H-imidazole-2-thione (PubChem CID 81334842) has the molecular formula C10H18N2OS and a molecular weight of 214.33 g/mol. Its IUPAC name is 3-(1-ethoxypropan-2-yl)-4-ethyl-1H-imidazole-2-thione.
| Compound Name | 3-(1-ethoxypropan-2-yl)-4-ethyl-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 81334842 |
| Molecular Formula | C10H18N2OS |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 3-(1-ethoxypropan-2-yl)-4-ethyl-1H-imidazole-2-thione |
| SMILES | CCOCC(C)n1c(CC)c[nH]c1=S |
| InChI | InChI=1S/C10H18N2OS/c1-4-9-6-11-10(14)12(9)8(3)7-13-5-2/h6,8H,4-5,7H2,1-3H3,(H,11,14) |
| InChIKey | BIGQSGMNUAFVNZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|