C13H9NO4 — CID 81357944
2-(2-methylfuran-3-yl)-1,3-benzoxazole-5-carboxylic acid (PubChem CID 81357944) has the molecular formula C13H9NO4 and a molecular weight of 243.22 g/mol. Its IUPAC name is 2-(2-methylfuran-3-yl)-1,3-benzoxazole-5-carboxylic acid.
| Compound Name | 2-(2-methylfuran-3-yl)-1,3-benzoxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 81357944 |
| Molecular Formula | C13H9NO4 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 2-(2-methylfuran-3-yl)-1,3-benzoxazole-5-carboxylic acid |
| SMILES | Cc1occc1-c1nc2cc(C(=O)O)ccc2o1 |
| InChI | InChI=1S/C13H9NO4/c1-7-9(4-5-17-7)12-14-10-6-8(13(15)16)2-3-11(10)18-12/h2-6H,1H3,(H,15,16) |
| InChIKey | OTDRZLFAFFEBSA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |