C14H29NO3 — CID 81412380
methyl 2-[[2-ethyl-2-(hydroxymethyl)butyl]amino]-3-methylpentanoate (PubChem CID 81412380) has the molecular formula C14H29NO3 and a molecular weight of 259.39 g/mol. Its IUPAC name is methyl 2-[[2-ethyl-2-(hydroxymethyl)butyl]amino]-3-methylpentanoate.
| Compound Name | methyl 2-[[2-ethyl-2-(hydroxymethyl)butyl]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 81412380 |
| Molecular Formula | C14H29NO3 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | methyl 2-[[2-ethyl-2-(hydroxymethyl)butyl]amino]-3-methylpentanoate |
| SMILES | CCC(C)C(NCC(CC)(CC)CO)C(=O)OC |
| InChI | InChI=1S/C14H29NO3/c1-6-11(4)12(13(17)18-5)15-9-14(7-2,8-3)10-16/h11-12,15-16H,6-10H2,1-5H3 |
| InChIKey | DLNMCFYXDMVKSL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |