C20H23N — CID 81417064
N-ethyl-3-(9H-fluoren-2-yl)-2-methylcyclobutan-1-amine (PubChem CID 81417064) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is N-ethyl-3-(9H-fluoren-2-yl)-2-methylcyclobutan-1-amine.
| Compound Name | N-ethyl-3-(9H-fluoren-2-yl)-2-methylcyclobutan-1-amine |
|---|---|
| PubChem CID | 81417064 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N-ethyl-3-(9H-fluoren-2-yl)-2-methylcyclobutan-1-amine |
| SMILES | CCNC1CC(c2ccc3c(c2)Cc2ccccc2-3)C1C |
| InChI | InChI=1S/C20H23N/c1-3-21-20-12-19(13(20)2)15-8-9-18-16(11-15)10-14-6-4-5-7-17(14)18/h4-9,11,13,19-21H,3,10,12H2,1-2H3 |
| InChIKey | OTTWJZKAAYGGAE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |