C16H22O4S — CID 81436972
3-(3,4-dimethylcyclohexyl)sulfonyl-2-methylbenzoic acid (PubChem CID 81436972) has the molecular formula C16H22O4S and a molecular weight of 310.42 g/mol. Its IUPAC name is 3-(3,4-dimethylcyclohexyl)sulfonyl-2-methylbenzoic acid.
| Compound Name | 3-(3,4-dimethylcyclohexyl)sulfonyl-2-methylbenzoic acid |
|---|---|
| PubChem CID | 81436972 |
| Molecular Formula | C16H22O4S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 3-(3,4-dimethylcyclohexyl)sulfonyl-2-methylbenzoic acid |
| SMILES | Cc1c(C(=O)O)cccc1S(=O)(=O)C1CCC(C)C(C)C1 |
| InChI | InChI=1S/C16H22O4S/c1-10-7-8-13(9-11(10)2)21(19,20)15-6-4-5-14(12(15)3)16(17)18/h4-6,10-11,13H,7-9H2,1-3H3,(H,17,18) |
| InChIKey | BUEYMQFZPGBXEE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |