C7H13BrF2O — CID 82004964
1-bromo-2-(2,2-difluoroethoxymethyl)butane (PubChem CID 82004964) has the molecular formula C7H13BrF2O and a molecular weight of 231.08 g/mol. Its IUPAC name is 1-bromo-2-(2,2-difluoroethoxymethyl)butane.
| Compound Name | 1-bromo-2-(2,2-difluoroethoxymethyl)butane |
|---|---|
| PubChem CID | 82004964 |
| Molecular Formula | C7H13BrF2O |
| Molecular Weight | 231.08 g/mol |
| Exact Mass | 230.01 |
| IUPAC Name | 1-bromo-2-(2,2-difluoroethoxymethyl)butane |
| SMILES | CCC(CBr)COCC(F)F |
| InChI | InChI=1S/C7H13BrF2O/c1-2-6(3-8)4-11-5-7(9)10/h6-7H,2-5H2,1H3 |
| InChIKey | XZFZGOXYVPJOHS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.08 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|