About propyl 2-amino-3-methyl-6-(1,3-oxazol-2-yl)benzoate
propyl 2-amino-3-methyl-6-(1,3-oxazol-2-yl)benzoate (PubChem CID 82015058) has the molecular formula C14H16N2O3
and a molecular weight of 260.29 g/mol. Its IUPAC name is propyl 2-amino-3-methyl-6-(1,3-oxazol-2-yl)benzoate.
Molecular Properties
| Compound Name | propyl 2-amino-3-methyl-6-(1,3-oxazol-2-yl)benzoate |
| PubChem CID | 82015058 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | propyl 2-amino-3-methyl-6-(1,3-oxazol-2-yl)benzoate |
| SMILES | CCCOC(=O)c1c(-c2ncco2)ccc(C)c1N |
| InChI | InChI=1S/C14H16N2O3/c1-3-7-19-14(17)11-10(13-16-6-8-18-13)5-4-9(2)12(11)15/h4-6,8H,3,7,15H2,1-2H3 |
| InChIKey | AFQCNDDWWWGAIM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze propyl 2-amino-3-methyl-6-(1,3-oxazol-2-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 2-amino-3-methyl-6-(1,3-oxazol-2-yl)benzoate?
The IUPAC name of propyl 2-amino-3-methyl-6-(1,3-oxazol-2-yl)benzoate (CID 82015058) is propyl 2-amino-3-methyl-6-(1,3-oxazol-2-yl)benzoate.
What is the SMILES notation for propyl 2-amino-3-methyl-6-(1,3-oxazol-2-yl)benzoate?
The canonical SMILES for propyl 2-amino-3-methyl-6-(1,3-oxazol-2-yl)benzoate is CCCOC(=O)c1c(-c2ncco2)ccc(C)c1N.
What is the InChIKey of propyl 2-amino-3-methyl-6-(1,3-oxazol-2-yl)benzoate?
The InChIKey is AFQCNDDWWWGAIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O3/c1-3-7-19-14(17)11-10(13-16-6-8-18-13)5-4-9(2)12(11)15/h4-6,8H,3,7,15H2,1-2H3.
What are the key properties of propyl 2-amino-3-methyl-6-(1,3-oxazol-2-yl)benzoate?
propyl 2-amino-3-methyl-6-(1,3-oxazol-2-yl)benzoate has a molecular weight of 260.29 g/mol, XLogP of 2.80, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 2-amino-3-methyl-6-(1,3-oxazol-2-yl)benzoate is sourced from PubChem (CID 82015058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).