C14H18N6O2S2 — CID 82018460
3-methyl-8-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-7-pentylpurine-2,6-dione (PubChem CID 82018460) has the molecular formula C14H18N6O2S2 and a molecular weight of 366.47 g/mol. Its IUPAC name is 3-methyl-8-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-7-pentylpurine-2,6-dione.
| Compound Name | 3-methyl-8-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-7-pentylpurine-2,6-dione |
|---|---|
| PubChem CID | 82018460 |
| Molecular Formula | C14H18N6O2S2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 3-methyl-8-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-7-pentylpurine-2,6-dione |
| SMILES | CCCCCn1c(Sc2nnc(C)s2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C14H18N6O2S2/c1-4-5-6-7-20-9-10(19(3)12(22)16-11(9)21)15-13(20)24-14-18-17-8(2)23-14/h4-7H2,1-3H3,(H,16,21,22) |
| InChIKey | ZHFOLHLJCWMXQU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|