C15H22ClN3S — CID 82020498
6-butyl-2-piperazin-1-yl-1,3-benzothiazole;hydrochloride (PubChem CID 82020498) has the molecular formula C15H22ClN3S and a molecular weight of 311.88 g/mol. Its IUPAC name is 6-butyl-2-piperazin-1-yl-1,3-benzothiazole;hydrochloride.
| Compound Name | 6-butyl-2-piperazin-1-yl-1,3-benzothiazole;hydrochloride |
|---|---|
| PubChem CID | 82020498 |
| Molecular Formula | C15H22ClN3S |
| Molecular Weight | 311.88 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 6-butyl-2-piperazin-1-yl-1,3-benzothiazole;hydrochloride |
| SMILES | CCCCc1ccc2nc(N3CCNCC3)sc2c1.Cl |
| InChI | InChI=1S/C15H21N3S.ClH/c1-2-3-4-12-5-6-13-14(11-12)19-15(17-13)18-9-7-16-8-10-18;/h5-6,11,16H,2-4,7-10H2,1H3;1H |
| InChIKey | KDDXKPYYJUBJLZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.88 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |