C15H14N2OS2 — CID 82028028
3-[(4-aminophenyl)methyl]-5-methyl-4-thiophen-2-yl-1,3-thiazol-2-one (PubChem CID 82028028) has the molecular formula C15H14N2OS2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 3-[(4-aminophenyl)methyl]-5-methyl-4-thiophen-2-yl-1,3-thiazol-2-one.
| Compound Name | 3-[(4-aminophenyl)methyl]-5-methyl-4-thiophen-2-yl-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 82028028 |
| Molecular Formula | C15H14N2OS2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 3-[(4-aminophenyl)methyl]-5-methyl-4-thiophen-2-yl-1,3-thiazol-2-one |
| SMILES | Cc1sc(=O)n(Cc2ccc(N)cc2)c1-c1cccs1 |
| InChI | InChI=1S/C15H14N2OS2/c1-10-14(13-3-2-8-19-13)17(15(18)20-10)9-11-4-6-12(16)7-5-11/h2-8H,9,16H2,1H3 |
| InChIKey | RVYUUKBHSPYXGK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|