C19H23N3O2S — CID 82035158
[2-(2,5-dimethoxyphenyl)-6-methyl-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazol-1-yl]methanamine (PubChem CID 82035158) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is [2-(2,5-dimethoxyphenyl)-6-methyl-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazol-1-yl]methanamine.
| Compound Name | [2-(2,5-dimethoxyphenyl)-6-methyl-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazol-1-yl]methanamine |
|---|---|
| PubChem CID | 82035158 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | [2-(2,5-dimethoxyphenyl)-6-methyl-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazol-1-yl]methanamine |
| SMILES | COc1ccc(OC)c(-c2nc3sc4c(n3c2CN)CCC(C)C4)c1 |
| InChI | InChI=1S/C19H23N3O2S/c1-11-4-6-14-17(8-11)25-19-21-18(15(10-20)22(14)19)13-9-12(23-2)5-7-16(13)24-3/h5,7,9,11H,4,6,8,10,20H2,1-3H3 |
| InChIKey | BDNHBJMXEDISED-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |