C15H20O — CID 82040234
3-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)butanal (PubChem CID 82040234) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is 3-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)butanal.
| Compound Name | 3-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)butanal |
|---|---|
| PubChem CID | 82040234 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 3-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)butanal |
| SMILES | CC(C)C(C=O)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C15H20O/c1-11(2)15(10-16)14-8-7-12-5-3-4-6-13(12)9-14/h7-11,15H,3-6H2,1-2H3 |
| InChIKey | IJXHCVFNYNDNCC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|