About 6-aminoimidazo[1,2-a]pyridine-2-carbonitrile
6-aminoimidazo[1,2-a]pyridine-2-carbonitrile (PubChem CID 82057718) has the molecular formula C8H6N4
and a molecular weight of 158.16 g/mol. Its IUPAC name is 6-aminoimidazo[1,2-a]pyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 6-aminoimidazo[1,2-a]pyridine-2-carbonitrile |
| PubChem CID | 82057718 |
| Molecular Formula | C8H6N4 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 6-aminoimidazo[1,2-a]pyridine-2-carbonitrile |
| SMILES | N#Cc1cn2cc(N)ccc2n1 |
| InChI | InChI=1S/C8H6N4/c9-3-7-5-12-4-6(10)1-2-8(12)11-7/h1-2,4-5H,10H2 |
| InChIKey | SLQIDYAGARCFKC-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 67.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-aminoimidazo[1,2-a]pyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-aminoimidazo[1,2-a]pyridine-2-carbonitrile?
The IUPAC name of 6-aminoimidazo[1,2-a]pyridine-2-carbonitrile (CID 82057718) is 6-aminoimidazo[1,2-a]pyridine-2-carbonitrile.
What is the SMILES notation for 6-aminoimidazo[1,2-a]pyridine-2-carbonitrile?
The canonical SMILES for 6-aminoimidazo[1,2-a]pyridine-2-carbonitrile is N#Cc1cn2cc(N)ccc2n1.
What is the InChIKey of 6-aminoimidazo[1,2-a]pyridine-2-carbonitrile?
The InChIKey is SLQIDYAGARCFKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N4/c9-3-7-5-12-4-6(10)1-2-8(12)11-7/h1-2,4-5H,10H2.
What are the key properties of 6-aminoimidazo[1,2-a]pyridine-2-carbonitrile?
6-aminoimidazo[1,2-a]pyridine-2-carbonitrile has a molecular weight of 158.16 g/mol, XLogP of 0.79, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-aminoimidazo[1,2-a]pyridine-2-carbonitrile is sourced from PubChem (CID 82057718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).