C11H13N3OS — CID 82059206
2-methoxy-1-N-(4-methyl-1,3-thiazol-2-yl)benzene-1,4-diamine (PubChem CID 82059206) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 2-methoxy-1-N-(4-methyl-1,3-thiazol-2-yl)benzene-1,4-diamine.
| Compound Name | 2-methoxy-1-N-(4-methyl-1,3-thiazol-2-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 82059206 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-methoxy-1-N-(4-methyl-1,3-thiazol-2-yl)benzene-1,4-diamine |
| SMILES | COc1cc(N)ccc1Nc1nc(C)cs1 |
| InChI | InChI=1S/C11H13N3OS/c1-7-6-16-11(13-7)14-9-4-3-8(12)5-10(9)15-2/h3-6H,12H2,1-2H3,(H,13,14) |
| InChIKey | ZSJOGQOBEHXTSF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|