C13H10BrN3O — CID 82060518
(5-bromo-2-pyridin-2-ylimidazo[1,2-a]pyridin-3-yl)methanol (PubChem CID 82060518) has the molecular formula C13H10BrN3O and a molecular weight of 304.15 g/mol. Its IUPAC name is (5-bromo-2-pyridin-2-ylimidazo[1,2-a]pyridin-3-yl)methanol.
| Compound Name | (5-bromo-2-pyridin-2-ylimidazo[1,2-a]pyridin-3-yl)methanol |
|---|---|
| PubChem CID | 82060518 |
| Molecular Formula | C13H10BrN3O |
| Molecular Weight | 304.15 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | (5-bromo-2-pyridin-2-ylimidazo[1,2-a]pyridin-3-yl)methanol |
| SMILES | OCc1c(-c2ccccn2)nc2cccc(Br)n12 |
| InChI | InChI=1S/C13H10BrN3O/c14-11-5-3-6-12-16-13(10(8-18)17(11)12)9-4-1-2-7-15-9/h1-7,18H,8H2 |
| InChIKey | HUSJVQSBGXDMCC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.15 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|