C17H13N3O2 — CID 82060867
3-formyl-2-(4-methoxyphenyl)-5-methylimidazo[1,2-a]pyridine-6-carbonitrile (PubChem CID 82060867) has the molecular formula C17H13N3O2 and a molecular weight of 291.31 g/mol. Its IUPAC name is 3-formyl-2-(4-methoxyphenyl)-5-methylimidazo[1,2-a]pyridine-6-carbonitrile.
| Compound Name | 3-formyl-2-(4-methoxyphenyl)-5-methylimidazo[1,2-a]pyridine-6-carbonitrile |
|---|---|
| PubChem CID | 82060867 |
| Molecular Formula | C17H13N3O2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 3-formyl-2-(4-methoxyphenyl)-5-methylimidazo[1,2-a]pyridine-6-carbonitrile |
| SMILES | COc1ccc(-c2nc3ccc(C#N)c(C)n3c2C=O)cc1 |
| InChI | InChI=1S/C17H13N3O2/c1-11-13(9-18)5-8-16-19-17(15(10-21)20(11)16)12-3-6-14(22-2)7-4-12/h3-8,10H,1-2H3 |
| InChIKey | ZYAOFBOFEITJPJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|