C18H15N3O2 — CID 82060873
2-(2-ethoxyphenyl)-3-formyl-5-methylimidazo[1,2-a]pyridine-6-carbonitrile (PubChem CID 82060873) has the molecular formula C18H15N3O2 and a molecular weight of 305.34 g/mol. Its IUPAC name is 2-(2-ethoxyphenyl)-3-formyl-5-methylimidazo[1,2-a]pyridine-6-carbonitrile.
| Compound Name | 2-(2-ethoxyphenyl)-3-formyl-5-methylimidazo[1,2-a]pyridine-6-carbonitrile |
|---|---|
| PubChem CID | 82060873 |
| Molecular Formula | C18H15N3O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-(2-ethoxyphenyl)-3-formyl-5-methylimidazo[1,2-a]pyridine-6-carbonitrile |
| SMILES | CCOc1ccccc1-c1nc2ccc(C#N)c(C)n2c1C=O |
| InChI | InChI=1S/C18H15N3O2/c1-3-23-16-7-5-4-6-14(16)18-15(11-22)21-12(2)13(10-19)8-9-17(21)20-18/h4-9,11H,3H2,1-2H3 |
| InChIKey | SVBQPJRQEQTXSH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|