About N-[3-(8-ethoxy-3,4-dihydro-2H-1,4-benzoxazin-6-yl)propyl]-N-ethylbutan-1-amine
N-[3-(8-ethoxy-3,4-dihydro-2H-1,4-benzoxazin-6-yl)propyl]-N-ethylbutan-1-amine (PubChem CID 82071623) has the molecular formula C19H32N2O2
and a molecular weight of 320.48 g/mol. Its IUPAC name is N-[3-(8-ethoxy-3,4-dihydro-2H-1,4-benzoxazin-6-yl)propyl]-N-ethylbutan-1-amine.
Molecular Properties
| Compound Name | N-[3-(8-ethoxy-3,4-dihydro-2H-1,4-benzoxazin-6-yl)propyl]-N-ethylbutan-1-amine |
| PubChem CID | 82071623 |
| Molecular Formula | C19H32N2O2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | N-[3-(8-ethoxy-3,4-dihydro-2H-1,4-benzoxazin-6-yl)propyl]-N-ethylbutan-1-amine |
| SMILES | CCCCN(CC)CCCc1cc2c(c(OCC)c1)OCCN2 |
| InChI | InChI=1S/C19H32N2O2/c1-4-7-11-21(5-2)12-8-9-16-14-17-19(23-13-10-20-17)18(15-16)22-6-3/h14-15,20H,4-13H2,1-3H3 |
| InChIKey | TVIJVYAVLGURKB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[3-(8-ethoxy-3,4-dihydro-2H-1,4-benzoxazin-6-yl)propyl]-N-ethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(8-ethoxy-3,4-dihydro-2H-1,4-benzoxazin-6-yl)propyl]-N-ethylbutan-1-amine?
The IUPAC name of N-[3-(8-ethoxy-3,4-dihydro-2H-1,4-benzoxazin-6-yl)propyl]-N-ethylbutan-1-amine (CID 82071623) is N-[3-(8-ethoxy-3,4-dihydro-2H-1,4-benzoxazin-6-yl)propyl]-N-ethylbutan-1-amine.
What is the SMILES notation for N-[3-(8-ethoxy-3,4-dihydro-2H-1,4-benzoxazin-6-yl)propyl]-N-ethylbutan-1-amine?
The canonical SMILES for N-[3-(8-ethoxy-3,4-dihydro-2H-1,4-benzoxazin-6-yl)propyl]-N-ethylbutan-1-amine is CCCCN(CC)CCCc1cc2c(c(OCC)c1)OCCN2.
What is the InChIKey of N-[3-(8-ethoxy-3,4-dihydro-2H-1,4-benzoxazin-6-yl)propyl]-N-ethylbutan-1-amine?
The InChIKey is TVIJVYAVLGURKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32N2O2/c1-4-7-11-21(5-2)12-8-9-16-14-17-19(23-13-10-20-17)18(15-16)22-6-3/h14-15,20H,4-13H2,1-3H3.
What are the key properties of N-[3-(8-ethoxy-3,4-dihydro-2H-1,4-benzoxazin-6-yl)propyl]-N-ethylbutan-1-amine?
N-[3-(8-ethoxy-3,4-dihydro-2H-1,4-benzoxazin-6-yl)propyl]-N-ethylbutan-1-amine has a molecular weight of 320.48 g/mol, XLogP of 3.94, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(8-ethoxy-3,4-dihydro-2H-1,4-benzoxazin-6-yl)propyl]-N-ethylbutan-1-amine is sourced from PubChem (CID 82071623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).