C13H17F2NO — CID 82084654
3-(3,4-difluorophenyl)-4,4-dimethylpentanamide (PubChem CID 82084654) has the molecular formula C13H17F2NO and a molecular weight of 241.28 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-4,4-dimethylpentanamide.
| Compound Name | 3-(3,4-difluorophenyl)-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 82084654 |
| Molecular Formula | C13H17F2NO |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 3-(3,4-difluorophenyl)-4,4-dimethylpentanamide |
| SMILES | CC(C)(C)C(CC(N)=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H17F2NO/c1-13(2,3)9(7-12(16)17)8-4-5-10(14)11(15)6-8/h4-6,9H,7H2,1-3H3,(H2,16,17) |
| InChIKey | YPAXWLMWAQWTQG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |