C13H14ClNS — CID 82087848
4-(chloromethyl)-2-[(2,4-dimethylphenyl)methyl]-1,3-thiazole (PubChem CID 82087848) has the molecular formula C13H14ClNS and a molecular weight of 251.78 g/mol. Its IUPAC name is 4-(chloromethyl)-2-[(2,4-dimethylphenyl)methyl]-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-[(2,4-dimethylphenyl)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 82087848 |
| Molecular Formula | C13H14ClNS |
| Molecular Weight | 251.78 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 4-(chloromethyl)-2-[(2,4-dimethylphenyl)methyl]-1,3-thiazole |
| SMILES | Cc1ccc(Cc2nc(CCl)cs2)c(C)c1 |
| InChI | InChI=1S/C13H14ClNS/c1-9-3-4-11(10(2)5-9)6-13-15-12(7-14)8-16-13/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | CWLUQINEJBQVRD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.78 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|