C15H18ClNO2 — CID 82104825
7-(2-chloropropanoyl)-3,5-diethyl-1,3-dihydroindol-2-one (PubChem CID 82104825) has the molecular formula C15H18ClNO2 and a molecular weight of 279.77 g/mol. Its IUPAC name is 7-(2-chloropropanoyl)-3,5-diethyl-1,3-dihydroindol-2-one.
| Compound Name | 7-(2-chloropropanoyl)-3,5-diethyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 82104825 |
| Molecular Formula | C15H18ClNO2 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 7-(2-chloropropanoyl)-3,5-diethyl-1,3-dihydroindol-2-one |
| SMILES | CCc1cc(C(=O)C(C)Cl)c2c(c1)C(CC)C(=O)N2 |
| InChI | InChI=1S/C15H18ClNO2/c1-4-9-6-11-10(5-2)15(19)17-13(11)12(7-9)14(18)8(3)16/h6-8,10H,4-5H2,1-3H3,(H,17,19) |
| InChIKey | GGMRDOINJRXPBC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|