C11H9N3OS — CID 82105993
4-(1,3-benzoxazol-5-yl)-5-methyl-1,3-thiazol-2-amine (PubChem CID 82105993) has the molecular formula C11H9N3OS and a molecular weight of 231.28 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-5-yl)-5-methyl-1,3-thiazol-2-amine.
| Compound Name | 4-(1,3-benzoxazol-5-yl)-5-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 82105993 |
| Molecular Formula | C11H9N3OS |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 4-(1,3-benzoxazol-5-yl)-5-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1sc(N)nc1-c1ccc2ocnc2c1 |
| InChI | InChI=1S/C11H9N3OS/c1-6-10(14-11(12)16-6)7-2-3-9-8(4-7)13-5-15-9/h2-5H,1H3,(H2,12,14) |
| InChIKey | BVORTJYRUIWFDI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |