C15H16F2N2S — CID 82106734
5-cyclohexyl-4-(3,5-difluorophenyl)-1,3-thiazol-2-amine (PubChem CID 82106734) has the molecular formula C15H16F2N2S and a molecular weight of 294.37 g/mol. Its IUPAC name is 5-cyclohexyl-4-(3,5-difluorophenyl)-1,3-thiazol-2-amine.
| Compound Name | 5-cyclohexyl-4-(3,5-difluorophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 82106734 |
| Molecular Formula | C15H16F2N2S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 5-cyclohexyl-4-(3,5-difluorophenyl)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2cc(F)cc(F)c2)c(C2CCCCC2)s1 |
| InChI | InChI=1S/C15H16F2N2S/c16-11-6-10(7-12(17)8-11)13-14(20-15(18)19-13)9-4-2-1-3-5-9/h6-9H,1-5H2,(H2,18,19) |
| InChIKey | BFVRCRPINIHQLR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |