C15H16ClFN2S — CID 114454504
4-(3-chloro-5-fluorophenyl)-2-cyclohexyl-1,3-thiazol-5-amine (PubChem CID 114454504) has the molecular formula C15H16ClFN2S and a molecular weight of 310.82 g/mol. Its IUPAC name is 4-(3-chloro-5-fluorophenyl)-2-cyclohexyl-1,3-thiazol-5-amine.
| Compound Name | 4-(3-chloro-5-fluorophenyl)-2-cyclohexyl-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 114454504 |
| Molecular Formula | C15H16ClFN2S |
| Molecular Weight | 310.82 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 4-(3-chloro-5-fluorophenyl)-2-cyclohexyl-1,3-thiazol-5-amine |
| SMILES | Nc1sc(C2CCCCC2)nc1-c1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C15H16ClFN2S/c16-11-6-10(7-12(17)8-11)13-14(18)20-15(19-13)9-4-2-1-3-5-9/h6-9H,1-5,18H2 |
| InChIKey | PKBQRAHUQSHWRK-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.82 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |