C14H17NO3 — CID 82130865
3-acetyl-5-[4-(dimethylamino)phenyl]oxolan-2-one (PubChem CID 82130865) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 3-acetyl-5-[4-(dimethylamino)phenyl]oxolan-2-one.
| Compound Name | 3-acetyl-5-[4-(dimethylamino)phenyl]oxolan-2-one |
|---|---|
| PubChem CID | 82130865 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 3-acetyl-5-[4-(dimethylamino)phenyl]oxolan-2-one |
| SMILES | CC(=O)C1CC(c2ccc(N(C)C)cc2)OC1=O |
| InChI | InChI=1S/C14H17NO3/c1-9(16)12-8-13(18-14(12)17)10-4-6-11(7-5-10)15(2)3/h4-7,12-13H,8H2,1-3H3 |
| InChIKey | DNQXLHOPZWYYAE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|