C14H18Cl2N2O — CID 82136391
1-(2,4-dichlorophenyl)-2-piperazin-1-ylbutan-1-one (PubChem CID 82136391) has the molecular formula C14H18Cl2N2O and a molecular weight of 301.22 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2-piperazin-1-ylbutan-1-one.
| Compound Name | 1-(2,4-dichlorophenyl)-2-piperazin-1-ylbutan-1-one |
|---|---|
| PubChem CID | 82136391 |
| Molecular Formula | C14H18Cl2N2O |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2-piperazin-1-ylbutan-1-one |
| SMILES | CCC(C(=O)c1ccc(Cl)cc1Cl)N1CCNCC1 |
| InChI | InChI=1S/C14H18Cl2N2O/c1-2-13(18-7-5-17-6-8-18)14(19)11-4-3-10(15)9-12(11)16/h3-4,9,13,17H,2,5-8H2,1H3 |
| InChIKey | LIERUTSKJMKCSA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |