C17H24N2O2 — CID 82136859
2-cyano-4-(2,5-dimethylphenoxy)-N,N-diethylbutanamide (PubChem CID 82136859) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-cyano-4-(2,5-dimethylphenoxy)-N,N-diethylbutanamide.
| Compound Name | 2-cyano-4-(2,5-dimethylphenoxy)-N,N-diethylbutanamide |
|---|---|
| PubChem CID | 82136859 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 2-cyano-4-(2,5-dimethylphenoxy)-N,N-diethylbutanamide |
| SMILES | CCN(CC)C(=O)C(C#N)CCOc1cc(C)ccc1C |
| InChI | InChI=1S/C17H24N2O2/c1-5-19(6-2)17(20)15(12-18)9-10-21-16-11-13(3)7-8-14(16)4/h7-8,11,15H,5-6,9-10H2,1-4H3 |
| InChIKey | PRGBRLMJEPKTJR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |