C18H26N2O2 — CID 82136874
2-cyano-N,N-diethyl-4-(2,3,6-trimethylphenoxy)butanamide (PubChem CID 82136874) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-cyano-N,N-diethyl-4-(2,3,6-trimethylphenoxy)butanamide.
| Compound Name | 2-cyano-N,N-diethyl-4-(2,3,6-trimethylphenoxy)butanamide |
|---|---|
| PubChem CID | 82136874 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 2-cyano-N,N-diethyl-4-(2,3,6-trimethylphenoxy)butanamide |
| SMILES | CCN(CC)C(=O)C(C#N)CCOc1c(C)ccc(C)c1C |
| InChI | InChI=1S/C18H26N2O2/c1-6-20(7-2)18(21)16(12-19)10-11-22-17-14(4)9-8-13(3)15(17)5/h8-9,16H,6-7,10-11H2,1-5H3 |
| InChIKey | GPKIYLKWGOODGD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |