C18H19BrN2O3 — CID 82144267
2-(2-bromo-3,4,5-trimethoxyphenyl)-5,6-dimethyl-1H-benzimidazole (PubChem CID 82144267) has the molecular formula C18H19BrN2O3 and a molecular weight of 391.27 g/mol. Its IUPAC name is 2-(2-bromo-3,4,5-trimethoxyphenyl)-5,6-dimethyl-1H-benzimidazole.
| Compound Name | 2-(2-bromo-3,4,5-trimethoxyphenyl)-5,6-dimethyl-1H-benzimidazole |
|---|---|
| PubChem CID | 82144267 |
| Molecular Formula | C18H19BrN2O3 |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 2-(2-bromo-3,4,5-trimethoxyphenyl)-5,6-dimethyl-1H-benzimidazole |
| SMILES | COc1cc(-c2nc3cc(C)c(C)cc3[nH]2)c(Br)c(OC)c1OC |
| InChI | InChI=1S/C18H19BrN2O3/c1-9-6-12-13(7-10(9)2)21-18(20-12)11-8-14(22-3)16(23-4)17(24-5)15(11)19/h6-8H,1-5H3,(H,20,21) |
| InChIKey | XUEOCRJSDWEQMX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 56.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |