C12H16N4O2 — CID 82148319
2-(2,4-dioxo-8-prop-2-enyl-1,3,8-triazaspiro[4.5]decan-3-yl)acetonitrile (PubChem CID 82148319) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 2-(2,4-dioxo-8-prop-2-enyl-1,3,8-triazaspiro[4.5]decan-3-yl)acetonitrile.
| Compound Name | 2-(2,4-dioxo-8-prop-2-enyl-1,3,8-triazaspiro[4.5]decan-3-yl)acetonitrile |
|---|---|
| PubChem CID | 82148319 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 2-(2,4-dioxo-8-prop-2-enyl-1,3,8-triazaspiro[4.5]decan-3-yl)acetonitrile |
| SMILES | C=CCN1CCC2(CC1)NC(=O)N(CC#N)C2=O |
| InChI | InChI=1S/C12H16N4O2/c1-2-6-15-7-3-12(4-8-15)10(17)16(9-5-13)11(18)14-12/h2H,1,3-4,6-9H2,(H,14,18) |
| InChIKey | CREFGYIALSONLF-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|