C10H16N2OS — CID 82155360
3-(3,5-dimethyl-1,2-oxazol-4-yl)-2,2-dimethylpropanethioamide (PubChem CID 82155360) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1,2-oxazol-4-yl)-2,2-dimethylpropanethioamide.
| Compound Name | 3-(3,5-dimethyl-1,2-oxazol-4-yl)-2,2-dimethylpropanethioamide |
|---|---|
| PubChem CID | 82155360 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 3-(3,5-dimethyl-1,2-oxazol-4-yl)-2,2-dimethylpropanethioamide |
| SMILES | Cc1noc(C)c1CC(C)(C)C(N)=S |
| InChI | InChI=1S/C10H16N2OS/c1-6-8(7(2)13-12-6)5-10(3,4)9(11)14/h5H2,1-4H3,(H2,11,14) |
| InChIKey | KUYCUYJEOMVIBH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|