C18H27NO3 — CID 82162521
2-(2,2-diethyl-3H-1,4-benzoxazin-4-yl)-2-ethylbutanoic acid (PubChem CID 82162521) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is 2-(2,2-diethyl-3H-1,4-benzoxazin-4-yl)-2-ethylbutanoic acid.
| Compound Name | 2-(2,2-diethyl-3H-1,4-benzoxazin-4-yl)-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 82162521 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 2-(2,2-diethyl-3H-1,4-benzoxazin-4-yl)-2-ethylbutanoic acid |
| SMILES | CCC1(CC)CN(C(CC)(CC)C(=O)O)c2ccccc2O1 |
| InChI | InChI=1S/C18H27NO3/c1-5-17(6-2)13-19(18(7-3,8-4)16(20)21)14-11-9-10-12-15(14)22-17/h9-12H,5-8,13H2,1-4H3,(H,20,21) |
| InChIKey | OSAGIWKXMYNRQS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |