C14H17N3O3 — CID 82171132
5-amino-2-[2-(2,3-dimethylphenoxy)ethyl]-1H-pyrimidine-4,6-dione (PubChem CID 82171132) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 5-amino-2-[2-(2,3-dimethylphenoxy)ethyl]-1H-pyrimidine-4,6-dione.
| Compound Name | 5-amino-2-[2-(2,3-dimethylphenoxy)ethyl]-1H-pyrimidine-4,6-dione |
|---|---|
| PubChem CID | 82171132 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 5-amino-2-[2-(2,3-dimethylphenoxy)ethyl]-1H-pyrimidine-4,6-dione |
| SMILES | Cc1cccc(OCCC2=NC(=O)C(N)C(=O)N2)c1C |
| InChI | InChI=1S/C14H17N3O3/c1-8-4-3-5-10(9(8)2)20-7-6-11-16-13(18)12(15)14(19)17-11/h3-5,12H,6-7,15H2,1-2H3,(H,16,17,18,19) |
| InChIKey | LDRMNBKPDYSXKP-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|