C18H19NO3 — CID 82172491
7-(1-hydroxy-2-phenoxyethyl)-3,5-dimethyl-1,3-dihydroindol-2-one (PubChem CID 82172491) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is 7-(1-hydroxy-2-phenoxyethyl)-3,5-dimethyl-1,3-dihydroindol-2-one.
| Compound Name | 7-(1-hydroxy-2-phenoxyethyl)-3,5-dimethyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 82172491 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 7-(1-hydroxy-2-phenoxyethyl)-3,5-dimethyl-1,3-dihydroindol-2-one |
| SMILES | Cc1cc(C(O)COc2ccccc2)c2c(c1)C(C)C(=O)N2 |
| InChI | InChI=1S/C18H19NO3/c1-11-8-14-12(2)18(21)19-17(14)15(9-11)16(20)10-22-13-6-4-3-5-7-13/h3-9,12,16,20H,10H2,1-2H3,(H,19,21) |
| InChIKey | NAPQPMUEJPBMMW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |