About 5-nonylsulfonylpentanoic acid
5-nonylsulfonylpentanoic acid (PubChem CID 82182716) has the molecular formula C14H28O4S
and a molecular weight of 292.44 g/mol. Its IUPAC name is 5-nonylsulfonylpentanoic acid.
Molecular Properties
| Compound Name | 5-nonylsulfonylpentanoic acid |
| PubChem CID | 82182716 |
| Molecular Formula | C14H28O4S |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 5-nonylsulfonylpentanoic acid |
| SMILES | CCCCCCCCCS(=O)(=O)CCCCC(=O)O |
| InChI | InChI=1S/C14H28O4S/c1-2-3-4-5-6-7-9-12-19(17,18)13-10-8-11-14(15)16/h2-13H2,1H3,(H,15,16) |
| InChIKey | HINGGYJWOAMHNX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-nonylsulfonylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nonylsulfonylpentanoic acid?
The IUPAC name of 5-nonylsulfonylpentanoic acid (CID 82182716) is 5-nonylsulfonylpentanoic acid.
What is the SMILES notation for 5-nonylsulfonylpentanoic acid?
The canonical SMILES for 5-nonylsulfonylpentanoic acid is CCCCCCCCCS(=O)(=O)CCCCC(=O)O.
What is the InChIKey of 5-nonylsulfonylpentanoic acid?
The InChIKey is HINGGYJWOAMHNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O4S/c1-2-3-4-5-6-7-9-12-19(17,18)13-10-8-11-14(15)16/h2-13H2,1H3,(H,15,16).
What are the key properties of 5-nonylsulfonylpentanoic acid?
5-nonylsulfonylpentanoic acid has a molecular weight of 292.44 g/mol, XLogP of 3.41, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nonylsulfonylpentanoic acid is sourced from PubChem (CID 82182716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).