C13H9NO3S2 — CID 82190423
2-[(2-thiophen-2-yl-1,3-benzothiazol-4-yl)oxy]acetic acid (PubChem CID 82190423) has the molecular formula C13H9NO3S2 and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-[(2-thiophen-2-yl-1,3-benzothiazol-4-yl)oxy]acetic acid.
| Compound Name | 2-[(2-thiophen-2-yl-1,3-benzothiazol-4-yl)oxy]acetic acid |
|---|---|
| PubChem CID | 82190423 |
| Molecular Formula | C13H9NO3S2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | 2-[(2-thiophen-2-yl-1,3-benzothiazol-4-yl)oxy]acetic acid |
| SMILES | O=C(O)COc1cccc2sc(-c3cccs3)nc12 |
| InChI | InChI=1S/C13H9NO3S2/c15-11(16)7-17-8-3-1-4-9-12(8)14-13(19-9)10-5-2-6-18-10/h1-6H,7H2,(H,15,16) |
| InChIKey | CQCUFRKGHAYBCU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |