C19H22ClN — CID 82214339
1-[2-chloro-2-(3,4-dimethylphenyl)ethyl]-3,4-dihydro-2H-quinoline (PubChem CID 82214339) has the molecular formula C19H22ClN and a molecular weight of 299.85 g/mol. Its IUPAC name is 1-[2-chloro-2-(3,4-dimethylphenyl)ethyl]-3,4-dihydro-2H-quinoline.
| Compound Name | 1-[2-chloro-2-(3,4-dimethylphenyl)ethyl]-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 82214339 |
| Molecular Formula | C19H22ClN |
| Molecular Weight | 299.85 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 1-[2-chloro-2-(3,4-dimethylphenyl)ethyl]-3,4-dihydro-2H-quinoline |
| SMILES | Cc1ccc(C(Cl)CN2CCCc3ccccc32)cc1C |
| InChI | InChI=1S/C19H22ClN/c1-14-9-10-17(12-15(14)2)18(20)13-21-11-5-7-16-6-3-4-8-19(16)21/h3-4,6,8-10,12,18H,5,7,11,13H2,1-2H3 |
| InChIKey | XKGFVNTYQOSZEA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.85 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|