C15H23NO3 — CID 82217025
2-[[2-hydroxy-2-[4-(2-methylpropyl)phenyl]ethyl]-methylamino]acetic acid (PubChem CID 82217025) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 2-[[2-hydroxy-2-[4-(2-methylpropyl)phenyl]ethyl]-methylamino]acetic acid.
| Compound Name | 2-[[2-hydroxy-2-[4-(2-methylpropyl)phenyl]ethyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 82217025 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 2-[[2-hydroxy-2-[4-(2-methylpropyl)phenyl]ethyl]-methylamino]acetic acid |
| SMILES | CC(C)Cc1ccc(C(O)CN(C)CC(=O)O)cc1 |
| InChI | InChI=1S/C15H23NO3/c1-11(2)8-12-4-6-13(7-5-12)14(17)9-16(3)10-15(18)19/h4-7,11,14,17H,8-10H2,1-3H3,(H,18,19) |
| InChIKey | LPLREEYDUJAFOY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |