C5H10N4 — CID 82234566
4-N,4-N-dimethyl-1H-pyrazole-4,5-diamine (PubChem CID 82234566) has the molecular formula C5H10N4 and a molecular weight of 126.16 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-1H-pyrazole-4,5-diamine.
| Compound Name | 4-N,4-N-dimethyl-1H-pyrazole-4,5-diamine |
|---|---|
| PubChem CID | 82234566 |
| Molecular Formula | C5H10N4 |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.09 |
| IUPAC Name | 4-N,4-N-dimethyl-1H-pyrazole-4,5-diamine |
| SMILES | CN(C)c1cn[nH]c1N |
| InChI | InChI=1S/C5H10N4/c1-9(2)4-3-7-8-5(4)6/h3H,1-2H3,(H3,6,7,8) |
| InChIKey | XNIKVEMCBNXLTP-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |