About 5-ethyl-4-hydroxy-2-methyl-2,3-dihydropyran-6-one
5-ethyl-4-hydroxy-2-methyl-2,3-dihydropyran-6-one (PubChem CID 82254013) has the molecular formula C8H12O3
and a molecular weight of 156.18 g/mol. Its IUPAC name is 5-ethyl-4-hydroxy-2-methyl-2,3-dihydropyran-6-one.
Analyze 5-ethyl-4-hydroxy-2-methyl-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-4-hydroxy-2-methyl-2,3-dihydropyran-6-one?
The IUPAC name of 5-ethyl-4-hydroxy-2-methyl-2,3-dihydropyran-6-one (CID 82254013) is 5-ethyl-4-hydroxy-2-methyl-2,3-dihydropyran-6-one.
What is the SMILES notation for 5-ethyl-4-hydroxy-2-methyl-2,3-dihydropyran-6-one?
The canonical SMILES for 5-ethyl-4-hydroxy-2-methyl-2,3-dihydropyran-6-one is CCC1=C(O)CC(C)OC1=O.
What is the InChIKey of 5-ethyl-4-hydroxy-2-methyl-2,3-dihydropyran-6-one?
The InChIKey is HLUCKTXVODDJSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O3/c1-3-6-7(9)4-5(2)11-8(6)10/h5,9H,3-4H2,1-2H3.
What are the key properties of 5-ethyl-4-hydroxy-2-methyl-2,3-dihydropyran-6-one?
5-ethyl-4-hydroxy-2-methyl-2,3-dihydropyran-6-one has a molecular weight of 156.18 g/mol, XLogP of 1.54, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-4-hydroxy-2-methyl-2,3-dihydropyran-6-one is sourced from PubChem (CID 82254013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).