C17H24N2 — CID 82255731
N-prop-2-enyl-N-[2-(1,2,3,4-tetrahydroquinolin-6-yl)ethyl]prop-2-en-1-amine (PubChem CID 82255731) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is N-prop-2-enyl-N-[2-(1,2,3,4-tetrahydroquinolin-6-yl)ethyl]prop-2-en-1-amine.
| Compound Name | N-prop-2-enyl-N-[2-(1,2,3,4-tetrahydroquinolin-6-yl)ethyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 82255731 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | N-prop-2-enyl-N-[2-(1,2,3,4-tetrahydroquinolin-6-yl)ethyl]prop-2-en-1-amine |
| SMILES | C=CCN(CC=C)CCc1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C17H24N2/c1-3-11-19(12-4-2)13-9-15-7-8-17-16(14-15)6-5-10-18-17/h3-4,7-8,14,18H,1-2,5-6,9-13H2 |
| InChIKey | MYZZRDUEBZHGKU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|