C13H13BrF3NO2 — CID 82258917
N-[4-(2-bromo-3-methylbutanoyl)phenyl]-2,2,2-trifluoroacetamide (PubChem CID 82258917) has the molecular formula C13H13BrF3NO2 and a molecular weight of 352.15 g/mol. Its IUPAC name is N-[4-(2-bromo-3-methylbutanoyl)phenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4-(2-bromo-3-methylbutanoyl)phenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 82258917 |
| Molecular Formula | C13H13BrF3NO2 |
| Molecular Weight | 352.15 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | N-[4-(2-bromo-3-methylbutanoyl)phenyl]-2,2,2-trifluoroacetamide |
| SMILES | CC(C)C(Br)C(=O)c1ccc(NC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H13BrF3NO2/c1-7(2)10(14)11(19)8-3-5-9(6-4-8)18-12(20)13(15,16)17/h3-7,10H,1-2H3,(H,18,20) |
| InChIKey | FRMSWWVKXZQONJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.15 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|